About 6-amino-2,3-dihydroxybenzaldehyde
6-amino-2,3-dihydroxybenzaldehyde (PubChem CID 54525793) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is 6-amino-2,3-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 6-amino-2,3-dihydroxybenzaldehyde |
| PubChem CID | 54525793 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 6-amino-2,3-dihydroxybenzaldehyde |
| SMILES | Nc1ccc(O)c(O)c1C=O |
| InChI | InChI=1S/C7H7NO3/c8-5-1-2-6(10)7(11)4(5)3-9/h1-3,10-11H,8H2 |
| InChIKey | YTACBFHQGJXEJD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2,3-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,3-dihydroxybenzaldehyde?
The IUPAC name of 6-amino-2,3-dihydroxybenzaldehyde (CID 54525793) is 6-amino-2,3-dihydroxybenzaldehyde.
What is the SMILES notation for 6-amino-2,3-dihydroxybenzaldehyde?
The canonical SMILES for 6-amino-2,3-dihydroxybenzaldehyde is Nc1ccc(O)c(O)c1C=O.
What is the InChIKey of 6-amino-2,3-dihydroxybenzaldehyde?
The InChIKey is YTACBFHQGJXEJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c8-5-1-2-6(10)7(11)4(5)3-9/h1-3,10-11H,8H2.
What are the key properties of 6-amino-2,3-dihydroxybenzaldehyde?
6-amino-2,3-dihydroxybenzaldehyde has a molecular weight of 153.14 g/mol, XLogP of 0.49, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,3-dihydroxybenzaldehyde is sourced from PubChem (CID 54525793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).