C18H28O3 — CID 54526042
(3aS,6aR)-3a-(4,4-dimethyl-3-oxooct-1-enyl)-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 54526042) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3aS,6aR)-3a-(4,4-dimethyl-3-oxooct-1-enyl)-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,6aR)-3a-(4,4-dimethyl-3-oxooct-1-enyl)-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 54526042 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3aS,6aR)-3a-(4,4-dimethyl-3-oxooct-1-enyl)-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(C)C(=O)C=C[C@@]12CCC[C@@]1(C)OC(=O)C2 |
| InChI | InChI=1S/C18H28O3/c1-5-6-9-16(2,3)14(19)8-12-18-11-7-10-17(18,4)21-15(20)13-18/h8,12H,5-7,9-11,13H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | YTEKAYFFZJBGKS-QZTJIDSGSA-N |
| XLogP | 4.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|