About 2-methylidene-3,4-dihydrothiochromene
2-methylidene-3,4-dihydrothiochromene (PubChem CID 54526175) has the molecular formula C10H10S
and a molecular weight of 162.26 g/mol. Its IUPAC name is 2-methylidene-3,4-dihydrothiochromene.
Molecular Properties
| Compound Name | 2-methylidene-3,4-dihydrothiochromene |
| PubChem CID | 54526175 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 2-methylidene-3,4-dihydrothiochromene |
| SMILES | C=C1CCc2ccccc2S1 |
| InChI | InChI=1S/C10H10S/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-5H,1,6-7H2 |
| InChIKey | CMXOKRYJNDTDCO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylidene-3,4-dihydrothiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3,4-dihydrothiochromene?
The IUPAC name of 2-methylidene-3,4-dihydrothiochromene (CID 54526175) is 2-methylidene-3,4-dihydrothiochromene.
What is the SMILES notation for 2-methylidene-3,4-dihydrothiochromene?
The canonical SMILES for 2-methylidene-3,4-dihydrothiochromene is C=C1CCc2ccccc2S1.
What is the InChIKey of 2-methylidene-3,4-dihydrothiochromene?
The InChIKey is CMXOKRYJNDTDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10S/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2-5H,1,6-7H2.
What are the key properties of 2-methylidene-3,4-dihydrothiochromene?
2-methylidene-3,4-dihydrothiochromene has a molecular weight of 162.26 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3,4-dihydrothiochromene is sourced from PubChem (CID 54526175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).