C32H60N4O2 — CID 54526430
N,N'-dibutyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enediamide (PubChem CID 54526430) has the molecular formula C32H60N4O2 and a molecular weight of 532.86 g/mol. Its IUPAC name is N,N'-dibutyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enediamide.
| Compound Name | N,N'-dibutyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enediamide |
|---|---|
| PubChem CID | 54526430 |
| Molecular Formula | C32H60N4O2 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.47 |
| IUPAC Name | N,N'-dibutyl-N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)but-2-enediamide |
| SMILES | CCCCN(C(=O)C=CC(=O)N(CCCC)C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C32H60N4O2/c1-13-15-19-35(25-21-29(3,4)33(11)30(5,6)22-25)27(37)17-18-28(38)36(20-16-14-2)26-23-31(7,8)34(12)32(9,10)24-26/h17-18,25-26H,13-16,19-24H2,1-12H3 |
| InChIKey | YTLAEPSIRZTANH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|