About (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate
(4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate (PubChem CID 54526917) has the molecular formula C21H36O3
and a molecular weight of 336.52 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate.
Molecular Properties
| Compound Name | (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate |
| PubChem CID | 54526917 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate |
| SMILES | CC(C)=CCCC(C)=CCOC(=O)OC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H36O3/c1-16(2)8-7-9-17(3)14-15-23-20(22)24-19-12-10-18(11-13-19)21(4,5)6/h8,14,18-19H,7,9-13,15H2,1-6H3 |
| InChIKey | YTTRRSCZTVQUIO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate?
The IUPAC name of (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate (CID 54526917) is (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate.
What is the SMILES notation for (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate?
The canonical SMILES for (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate is CC(C)=CCCC(C)=CCOC(=O)OC1CCC(C(C)(C)C)CC1.
What is the InChIKey of (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate?
The InChIKey is YTTRRSCZTVQUIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O3/c1-16(2)8-7-9-17(3)14-15-23-20(22)24-19-12-10-18(11-13-19)21(4,5)6/h8,14,18-19H,7,9-13,15H2,1-6H3.
What are the key properties of (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate?
(4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate has a molecular weight of 336.52 g/mol, XLogP of 6.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylcyclohexyl) 3,7-dimethylocta-2,6-dienyl carbonate is sourced from PubChem (CID 54526917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).