C43H78O8 — CID 54527335
[(2R,3R,4S,5R)-1,2,3-trihydroxy-5-octadec-9-enoyloxy-6-oxoheptan-4-yl] octadec-9-enoate (PubChem CID 54527335) has the molecular formula C43H78O8 and a molecular weight of 723.09 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-1,2,3-trihydroxy-5-octadec-9-enoyloxy-6-oxoheptan-4-yl] octadec-9-enoate.
| Compound Name | [(2R,3R,4S,5R)-1,2,3-trihydroxy-5-octadec-9-enoyloxy-6-oxoheptan-4-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 54527335 |
| Molecular Formula | C43H78O8 |
| Molecular Weight | 723.09 g/mol |
| Exact Mass | 722.57 |
| IUPAC Name | [(2R,3R,4S,5R)-1,2,3-trihydroxy-5-octadec-9-enoyloxy-6-oxoheptan-4-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](OC(=O)CCCCCCCC=CCCCCCCCC)C(C)=O |
| InChI | InChI=1S/C43H78O8/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-39(47)50-42(37(3)45)43(41(49)38(46)36-44)51-40(48)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,38,41-44,46,49H,4-17,22-36H2,1-3H3/t38-,41-,42+,43+/m1/s1 |
| InChIKey | YUBCKFPRINZQFK-GKUXIHSCSA-N |
| XLogP | 10.19 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.09 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|