C20H12O4 — CID 54527768
17-methyl-7,14-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(13),2(10),3,5(9),11,15(20),16,18-octaene-6,8-dione (PubChem CID 54527768) has the molecular formula C20H12O4 and a molecular weight of 316.31 g/mol. Its IUPAC name is 17-methyl-7,14-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(13),2(10),3,5(9),11,15(20),16,18-octaene-6,8-dione.
| Compound Name | 17-methyl-7,14-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(13),2(10),3,5(9),11,15(20),16,18-octaene-6,8-dione |
|---|---|
| PubChem CID | 54527768 |
| Molecular Formula | C20H12O4 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 17-methyl-7,14-dioxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-1(13),2(10),3,5(9),11,15(20),16,18-octaene-6,8-dione |
| SMILES | Cc1ccc2c(c1)Oc1ccc3c4c(ccc3c1C2)C(=O)OC4=O |
| InChI | InChI=1S/C20H12O4/c1-10-2-3-11-9-15-12-4-5-14-18(20(22)24-19(14)21)13(12)6-7-16(15)23-17(11)8-10/h2-8H,9H2,1H3 |
| InChIKey | YUHXJUHMUNEUKC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|