C28H46O5Si — CID 54528029
[(13S)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 54528029) has the molecular formula C28H46O5Si and a molecular weight of 490.76 g/mol. Its IUPAC name is [(13S)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(13S)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 54528029 |
| Molecular Formula | C28H46O5Si |
| Molecular Weight | 490.76 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [(13S)-7-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1C=C2CC(O[Si](C)(C)C(C)(C)C)CCC2C2CC[C@]3(C)C(OC(C)=O)CCC3C12 |
| InChI | InChI=1S/C28H46O5Si/c1-17(29)31-24-16-19-15-20(33-34(7,8)27(3,4)5)9-10-21(19)22-13-14-28(6)23(26(22)24)11-12-25(28)32-18(2)30/h16,20-26H,9-15H2,1-8H3/t20?,21?,22?,23?,24?,25?,26?,28-/m0/s1 |
| InChIKey | YUMPXSMZIQBTRV-NHSACYBASA-N |
| XLogP | 6.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|