C13H20N4O3S2 — CID 54528577
methyl (2S)-2-[cyclohexyl-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoyl]amino]propanoate (PubChem CID 54528577) has the molecular formula C13H20N4O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is methyl (2S)-2-[cyclohexyl-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[cyclohexyl-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 54528577 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl (2S)-2-[cyclohexyl-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C(=O)Nc1n[nH]c(=S)s1)C1CCCCC1 |
| InChI | InChI=1S/C13H20N4O3S2/c1-8(10(18)20-2)17(9-6-4-3-5-7-9)12(19)14-11-15-16-13(21)22-11/h8-9H,3-7H2,1-2H3,(H,16,21)(H,14,15,19)/t8-/m0/s1 |
| InChIKey | YUWRMEVXQAZDRV-QMMMGPOBSA-N |
| XLogP | 2.93 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|