C17H31NS — CID 54528726
2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethanamine (PubChem CID 54528726) has the molecular formula C17H31NS and a molecular weight of 281.51 g/mol. Its IUPAC name is 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethanamine.
| Compound Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 54528726 |
| Molecular Formula | C17H31NS |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)ethanamine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSCCN |
| InChI | InChI=1S/C17H31NS/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-13-19-14-12-18/h7,9,11H,5-6,8,10,12-14,18H2,1-4H3 |
| InChIKey | YUZCVCCEDSJPQP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|