About 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid
2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid (PubChem CID 54529085) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid.
Molecular Properties
| Compound Name | 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid |
| PubChem CID | 54529085 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid |
| SMILES | CC1=C(CCC(C)C=C(C#N)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H25NO2/c1-12(10-14(11-18)16(19)20)7-8-15-13(2)6-5-9-17(15,3)4/h10,12H,5-9H2,1-4H3,(H,19,20) |
| InChIKey | YVFAIRUETMDUAW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid?
The IUPAC name of 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid (CID 54529085) is 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid.
What is the SMILES notation for 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid?
The canonical SMILES for 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid is CC1=C(CCC(C)C=C(C#N)C(=O)O)C(C)(C)CCC1.
What is the InChIKey of 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid?
The InChIKey is YVFAIRUETMDUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-12(10-14(11-18)16(19)20)7-8-15-13(2)6-5-9-17(15,3)4/h10,12H,5-9H2,1-4H3,(H,19,20).
What are the key properties of 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid?
2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid has a molecular weight of 275.39 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-enoic acid is sourced from PubChem (CID 54529085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).