About N-(4-ethylhexa-2,4-dienyl)acetamide
N-(4-ethylhexa-2,4-dienyl)acetamide (PubChem CID 54529329) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-(4-ethylhexa-2,4-dienyl)acetamide.
Molecular Properties
| Compound Name | N-(4-ethylhexa-2,4-dienyl)acetamide |
| PubChem CID | 54529329 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-(4-ethylhexa-2,4-dienyl)acetamide |
| SMILES | CC=C(C=CCNC(C)=O)CC |
| InChI | InChI=1S/C10H17NO/c1-4-10(5-2)7-6-8-11-9(3)12/h4,6-7H,5,8H2,1-3H3,(H,11,12) |
| InChIKey | YVJRDKVIQOIUDQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethylhexa-2,4-dienyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethylhexa-2,4-dienyl)acetamide?
The IUPAC name of N-(4-ethylhexa-2,4-dienyl)acetamide (CID 54529329) is N-(4-ethylhexa-2,4-dienyl)acetamide.
What is the SMILES notation for N-(4-ethylhexa-2,4-dienyl)acetamide?
The canonical SMILES for N-(4-ethylhexa-2,4-dienyl)acetamide is CC=C(C=CCNC(C)=O)CC.
What is the InChIKey of N-(4-ethylhexa-2,4-dienyl)acetamide?
The InChIKey is YVJRDKVIQOIUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-4-10(5-2)7-6-8-11-9(3)12/h4,6-7H,5,8H2,1-3H3,(H,11,12).
What are the key properties of N-(4-ethylhexa-2,4-dienyl)acetamide?
N-(4-ethylhexa-2,4-dienyl)acetamide has a molecular weight of 167.25 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylhexa-2,4-dienyl)acetamide is sourced from PubChem (CID 54529329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).