C8H9F5S — CID 54529781
2,2-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)-3H-thiophene (PubChem CID 54529781) has the molecular formula C8H9F5S and a molecular weight of 232.22 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)-3H-thiophene.
| Compound Name | 2,2-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)-3H-thiophene |
|---|---|
| PubChem CID | 54529781 |
| Molecular Formula | C8H9F5S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2,2-dimethyl-5-(1,1,2,2,2-pentafluoroethyl)-3H-thiophene |
| SMILES | CC1(C)CC=C(C(F)(F)C(F)(F)F)S1 |
| InChI | InChI=1S/C8H9F5S/c1-6(2)4-3-5(14-6)7(9,10)8(11,12)13/h3H,4H2,1-2H3 |
| InChIKey | YVRJHDJOILGUGM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|