C33H56O6 — CID 54529851
methyl 7-[(4R,5R)-5-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)cyclopenten-1-yl]heptanoate (PubChem CID 54529851) has the molecular formula C33H56O6 and a molecular weight of 548.81 g/mol. Its IUPAC name is methyl 7-[(4R,5R)-5-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)cyclopenten-1-yl]heptanoate.
| Compound Name | methyl 7-[(4R,5R)-5-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)cyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 54529851 |
| Molecular Formula | C33H56O6 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | methyl 7-[(4R,5R)-5-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)cyclopenten-1-yl]heptanoate |
| SMILES | CCCCC(C)(C)[C@@H](C=C[C@@H]1C(CCCCCCC(=O)OC)=CC[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C33H56O6/c1-5-6-23-33(2,3)29(39-32-18-12-14-25-37-32)22-20-27-26(15-9-7-8-10-16-30(34)35-4)19-21-28(27)38-31-17-11-13-24-36-31/h19-20,22,27-29,31-32H,5-18,21,23-25H2,1-4H3/t27-,28-,29-,31?,32?/m1/s1 |
| InChIKey | YVSLLLTVCBFFEZ-ZIQMFUFLSA-N |
| XLogP | 8.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|