C22H25N3O2 — CID 54529902
(1R,9R,10R)-17-methyl-4-(3-nitro-2-pyridinyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 54529902) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (1R,9R,10R)-17-methyl-4-(3-nitro-2-pyridinyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10R)-17-methyl-4-(3-nitro-2-pyridinyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 54529902 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (1R,9R,10R)-17-methyl-4-(3-nitro-2-pyridinyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(-c2ncccc2[N+](=O)[O-])cc13 |
| InChI | InChI=1S/C22H25N3O2/c1-24-12-10-22-9-3-2-5-17(22)20(24)14-15-7-8-16(13-18(15)22)21-19(25(26)27)6-4-11-23-21/h4,6-8,11,13,17,20H,2-3,5,9-10,12,14H2,1H3/t17-,20+,22+/m0/s1 |
| InChIKey | YVTODPINJLYJCP-UCNVEGJOSA-N |
| XLogP | 4.34 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|