About N-ethylsulfonyl-2,2,2-trifluoroacetamide
N-ethylsulfonyl-2,2,2-trifluoroacetamide (PubChem CID 54530111) has the molecular formula C4H6F3NO3S
and a molecular weight of 205.16 g/mol. Its IUPAC name is N-ethylsulfonyl-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-ethylsulfonyl-2,2,2-trifluoroacetamide |
| PubChem CID | 54530111 |
| Molecular Formula | C4H6F3NO3S |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | N-ethylsulfonyl-2,2,2-trifluoroacetamide |
| SMILES | CCS(=O)(=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C4H6F3NO3S/c1-2-12(10,11)8-3(9)4(5,6)7/h2H2,1H3,(H,8,9) |
| InChIKey | YVXLPTXLUXIENS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylsulfonyl-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylsulfonyl-2,2,2-trifluoroacetamide?
The IUPAC name of N-ethylsulfonyl-2,2,2-trifluoroacetamide (CID 54530111) is N-ethylsulfonyl-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-ethylsulfonyl-2,2,2-trifluoroacetamide?
The canonical SMILES for N-ethylsulfonyl-2,2,2-trifluoroacetamide is CCS(=O)(=O)NC(=O)C(F)(F)F.
What is the InChIKey of N-ethylsulfonyl-2,2,2-trifluoroacetamide?
The InChIKey is YVXLPTXLUXIENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F3NO3S/c1-2-12(10,11)8-3(9)4(5,6)7/h2H2,1H3,(H,8,9).
What are the key properties of N-ethylsulfonyl-2,2,2-trifluoroacetamide?
N-ethylsulfonyl-2,2,2-trifluoroacetamide has a molecular weight of 205.16 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylsulfonyl-2,2,2-trifluoroacetamide is sourced from PubChem (CID 54530111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).