C15H15N — CID 54530112
tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaen-2-amine (PubChem CID 54530112) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaen-2-amine.
| Compound Name | tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaen-2-amine |
|---|---|
| PubChem CID | 54530112 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,8,10,13-hexaen-2-amine |
| SMILES | NC1C2=CC=CCC2=CC=C2C=CC=CC21 |
| InChI | InChI=1S/C15H15N/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-5,7-10,13,15H,6,16H2 |
| InChIKey | YVXLQHRLMFUETN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |