About N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide
N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide (PubChem CID 54530156) has the molecular formula C21H36N2O3S
and a molecular weight of 396.60 g/mol. Its IUPAC name is N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide |
| PubChem CID | 54530156 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide |
| SMILES | CCCCCCCCCn1c(O)cc(SCCN(C=O)C2CCCC2)c1O |
| InChI | InChI=1S/C21H36N2O3S/c1-2-3-4-5-6-7-10-13-23-20(25)16-19(21(23)26)27-15-14-22(17-24)18-11-8-9-12-18/h16-18,25-26H,2-15H2,1H3 |
| InChIKey | YVYHKKXCTASATH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide?
The IUPAC name of N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide (CID 54530156) is N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide.
What is the SMILES notation for N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide?
The canonical SMILES for N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide is CCCCCCCCCn1c(O)cc(SCCN(C=O)C2CCCC2)c1O.
What is the InChIKey of N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide?
The InChIKey is YVYHKKXCTASATH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O3S/c1-2-3-4-5-6-7-10-13-23-20(25)16-19(21(23)26)27-15-14-22(17-24)18-11-8-9-12-18/h16-18,25-26H,2-15H2,1H3.
What are the key properties of N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide?
N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide has a molecular weight of 396.60 g/mol, XLogP of 5.14, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]formamide is sourced from PubChem (CID 54530156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).