About (4-chlorothiophen-3-yl) 2-oxopropanoate
(4-chlorothiophen-3-yl) 2-oxopropanoate (PubChem CID 54530223) has the molecular formula C7H5ClO3S
and a molecular weight of 204.63 g/mol. Its IUPAC name is (4-chlorothiophen-3-yl) 2-oxopropanoate.
Molecular Properties
| Compound Name | (4-chlorothiophen-3-yl) 2-oxopropanoate |
| PubChem CID | 54530223 |
| Molecular Formula | C7H5ClO3S |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | (4-chlorothiophen-3-yl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)Oc1cscc1Cl |
| InChI | InChI=1S/C7H5ClO3S/c1-4(9)7(10)11-6-3-12-2-5(6)8/h2-3H,1H3 |
| InChIKey | YVZPLZJFMQOFLQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorothiophen-3-yl) 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorothiophen-3-yl) 2-oxopropanoate?
The IUPAC name of (4-chlorothiophen-3-yl) 2-oxopropanoate (CID 54530223) is (4-chlorothiophen-3-yl) 2-oxopropanoate.
What is the SMILES notation for (4-chlorothiophen-3-yl) 2-oxopropanoate?
The canonical SMILES for (4-chlorothiophen-3-yl) 2-oxopropanoate is CC(=O)C(=O)Oc1cscc1Cl.
What is the InChIKey of (4-chlorothiophen-3-yl) 2-oxopropanoate?
The InChIKey is YVZPLZJFMQOFLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO3S/c1-4(9)7(10)11-6-3-12-2-5(6)8/h2-3H,1H3.
What are the key properties of (4-chlorothiophen-3-yl) 2-oxopropanoate?
(4-chlorothiophen-3-yl) 2-oxopropanoate has a molecular weight of 204.63 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorothiophen-3-yl) 2-oxopropanoate is sourced from PubChem (CID 54530223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).