About 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate
2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate (PubChem CID 54530478) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate.
Molecular Properties
| Compound Name | 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate |
| PubChem CID | 54530478 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate |
| SMILES | C=C(C)C(=O)C=C(C)C(=O)OCCN |
| InChI | InChI=1S/C10H15NO3/c1-7(2)9(12)6-8(3)10(13)14-5-4-11/h6H,1,4-5,11H2,2-3H3 |
| InChIKey | YWECEVSBIUDWLX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
The IUPAC name of 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate (CID 54530478) is 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate.
What is the SMILES notation for 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
The canonical SMILES for 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate is C=C(C)C(=O)C=C(C)C(=O)OCCN.
What is the InChIKey of 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
The InChIKey is YWECEVSBIUDWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-7(2)9(12)6-8(3)10(13)14-5-4-11/h6H,1,4-5,11H2,2-3H3.
What are the key properties of 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate has a molecular weight of 197.23 g/mol, XLogP of 0.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2,5-dimethyl-4-oxohexa-2,5-dienoate is sourced from PubChem (CID 54530478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).