C16H20F12I2Si2 — CID 54530548
(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diiodo-10-trimethylsilyldeca-1,9-dienyl)-trimethylsilane (PubChem CID 54530548) has the molecular formula C16H20F12I2Si2 and a molecular weight of 750.29 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diiodo-10-trimethylsilyldeca-1,9-dienyl)-trimethylsilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diiodo-10-trimethylsilyldeca-1,9-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 54530548 |
| Molecular Formula | C16H20F12I2Si2 |
| Molecular Weight | 750.29 g/mol |
| Exact Mass | 749.90 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-1,10-diiodo-10-trimethylsilyldeca-1,9-dienyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C(I)[Si](C)(C)C |
| InChI | InChI=1S/C16H20F12I2Si2/c1-31(2,3)9(29)7-11(17,18)13(21,22)15(25,26)16(27,28)14(23,24)12(19,20)8-10(30)32(4,5)6/h7-8H,1-6H3 |
| InChIKey | YWFIVSFIUWTUJB-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.29 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|