C16H30OS — CID 54530583
3,7,11-trimethyl-11-methylsulfanyldodeca-2,4-dien-1-ol (PubChem CID 54530583) has the molecular formula C16H30OS and a molecular weight of 270.48 g/mol. Its IUPAC name is 3,7,11-trimethyl-11-methylsulfanyldodeca-2,4-dien-1-ol.
| Compound Name | 3,7,11-trimethyl-11-methylsulfanyldodeca-2,4-dien-1-ol |
|---|---|
| PubChem CID | 54530583 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 3,7,11-trimethyl-11-methylsulfanyldodeca-2,4-dien-1-ol |
| SMILES | CSC(C)(C)CCCC(C)CC=CC(C)=CCO |
| InChI | InChI=1S/C16H30OS/c1-14(8-6-9-15(2)11-13-17)10-7-12-16(3,4)18-5/h6,9,11,14,17H,7-8,10,12-13H2,1-5H3 |
| InChIKey | YWGAYMLWIGYBNH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|