C69H80F6O10 — CID 54530729
[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-decoxyphenyl)benzoate;[4-(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 54530729) has the molecular formula C69H80F6O10 and a molecular weight of 1183.38 g/mol. Its IUPAC name is [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-decoxyphenyl)benzoate;[4-(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-decoxyphenyl)benzoate;[4-(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 54530729 |
| Molecular Formula | C69H80F6O10 |
| Molecular Weight | 1183.38 g/mol |
| Exact Mass | 1182.57 |
| IUPAC Name | [4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl] 4-(4-decoxyphenyl)benzoate;[4-(1,1,1-trifluoropropan-2-yloxycarbonyl)phenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cc2)cc1.CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H47F3O5.C31H33F3O5/c1-3-5-7-9-10-11-12-14-28-44-33-24-20-30(21-25-33)29-16-18-31(19-17-29)36(42)45-34-26-22-32(23-27-34)37(43)46-35(38(39,40)41)15-13-8-6-4-2;1-3-4-5-6-7-8-21-37-27-17-13-24(14-18-27)23-9-11-25(12-10-23)30(36)39-28-19-15-26(16-20-28)29(35)38-22(2)31(32,33)34/h16-27,35H,3-15,28H2,1-2H3;9-20,22H,3-8,21H2,1-2H3 |
| InChIKey | YWIFQCQPSWCATF-UHFFFAOYSA-N |
| XLogP | 19.57 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1183.38 |
| LogP ≤ 5 | 19.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|