C10H10FNO6S — CID 54530763
5-fluoro-2-[(2-methoxy-2-oxoethyl)sulfonylamino]benzoic acid (PubChem CID 54530763) has the molecular formula C10H10FNO6S and a molecular weight of 291.26 g/mol. Its IUPAC name is 5-fluoro-2-[(2-methoxy-2-oxoethyl)sulfonylamino]benzoic acid.
| Compound Name | 5-fluoro-2-[(2-methoxy-2-oxoethyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 54530763 |
| Molecular Formula | C10H10FNO6S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-fluoro-2-[(2-methoxy-2-oxoethyl)sulfonylamino]benzoic acid |
| SMILES | COC(=O)CS(=O)(=O)Nc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C10H10FNO6S/c1-18-9(13)5-19(16,17)12-8-3-2-6(11)4-7(8)10(14)15/h2-4,12H,5H2,1H3,(H,14,15) |
| InChIKey | YWIZJIUMSOCIEX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |