About 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol
2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol (PubChem CID 54531237) has the molecular formula C16H18S
and a molecular weight of 242.39 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol |
| PubChem CID | 54531237 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol |
| SMILES | Cc1ccc(-c2c(S)ccc(C)c2C)cc1C |
| InChI | InChI=1S/C16H18S/c1-10-5-7-14(9-12(10)3)16-13(4)11(2)6-8-15(16)17/h5-9,17H,1-4H3 |
| InChIKey | YWRTXMWGOIEQSR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol?
The IUPAC name of 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol (CID 54531237) is 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol.
What is the SMILES notation for 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol?
The canonical SMILES for 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol is Cc1ccc(-c2c(S)ccc(C)c2C)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol?
The InChIKey is YWRTXMWGOIEQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18S/c1-10-5-7-14(9-12(10)3)16-13(4)11(2)6-8-15(16)17/h5-9,17H,1-4H3.
What are the key properties of 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol?
2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol has a molecular weight of 242.39 g/mol, XLogP of 4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)-3,4-dimethylbenzenethiol is sourced from PubChem (CID 54531237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).