C16H7NO5 — CID 54531348
4-nitro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione (PubChem CID 54531348) has the molecular formula C16H7NO5 and a molecular weight of 293.23 g/mol. Its IUPAC name is 4-nitro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione.
| Compound Name | 4-nitro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 54531348 |
| Molecular Formula | C16H7NO5 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4-nitro-11-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
| SMILES | O=C1OC(=O)c2cc3ccc([N+](=O)[O-])cc3c3cccc1c23 |
| InChI | InChI=1S/C16H7NO5/c18-15-11-3-1-2-10-12-7-9(17(20)21)5-4-8(12)6-13(14(10)11)16(19)22-15/h1-7H |
| InChIKey | YWTYZNBXMQGHFW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|