About (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium
(4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium (PubChem CID 54531807) has the molecular formula C8H11N2+
and a molecular weight of 135.19 g/mol. Its IUPAC name is (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium.
Molecular Properties
| Compound Name | (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium |
| PubChem CID | 54531807 |
| Molecular Formula | C8H11N2+ |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium |
| SMILES | [H]N=C1C=CC(=[N+](C)C)C=C1 |
| InChI | InChI=1S/C8H11N2/c1-10(2)8-5-3-7(9)4-6-8/h3-6,9H,1-2H3/q+1 |
| InChIKey | YXBRSYBKYPDUME-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 26.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium?
The IUPAC name of (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium (CID 54531807) is (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium.
What is the SMILES notation for (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium?
The canonical SMILES for (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium is [H]N=C1C=CC(=[N+](C)C)C=C1.
What is the InChIKey of (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium?
The InChIKey is YXBRSYBKYPDUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2/c1-10(2)8-5-3-7(9)4-6-8/h3-6,9H,1-2H3/q+1.
What are the key properties of (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium?
(4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium has a molecular weight of 135.19 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iminocyclohexa-2,5-dien-1-ylidene)-dimethylazanium is sourced from PubChem (CID 54531807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).