C18H21F15O4 — CID 54531823
(2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]dec-9-en-2-ol (PubChem CID 54531823) has the molecular formula C18H21F15O4 and a molecular weight of 586.33 g/mol. Its IUPAC name is (2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]dec-9-en-2-ol.
| Compound Name | (2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]dec-9-en-2-ol |
|---|---|
| PubChem CID | 54531823 |
| Molecular Formula | C18H21F15O4 |
| Molecular Weight | 586.33 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | (2R)-1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]dec-9-en-2-ol |
| SMILES | C=CCCCCCC[C@@H](O)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H21F15O4/c1-2-3-4-5-6-7-8-11(34)9-35-10-12(19,20)36-17(30,31)18(32,33)37-16(28,29)14(23,24)13(21,22)15(25,26)27/h2,11,34H,1,3-10H2/t11-/m1/s1 |
| InChIKey | YXBXUTOVPLGAAU-LLVKDONJSA-N |
| XLogP | 7.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.33 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|