C33H46O8 — CID 54531864
4-[(3R)-3-[[(1R,5S)-2-methylidene-5-(4-phenoxybutyl)cyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid (PubChem CID 54531864) has the molecular formula C33H46O8 and a molecular weight of 570.72 g/mol. Its IUPAC name is 4-[(3R)-3-[[(1R,5S)-2-methylidene-5-(4-phenoxybutyl)cyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid.
| Compound Name | 4-[(3R)-3-[[(1R,5S)-2-methylidene-5-(4-phenoxybutyl)cyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid |
|---|---|
| PubChem CID | 54531864 |
| Molecular Formula | C33H46O8 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 4-[(3R)-3-[[(1R,5S)-2-methylidene-5-(4-phenoxybutyl)cyclopentyl]methyl]oxiran-2-yl]-2,3-bis(oxan-2-yloxy)but-2-enoic acid |
| SMILES | C=C1CC[C@H](CCCCOc2ccccc2)[C@H]1C[C@H]1OC1CC(OC1CCCCO1)=C(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C33H46O8/c1-23-16-17-24(11-5-8-18-36-25-12-3-2-4-13-25)26(23)21-27-28(39-27)22-29(40-30-14-6-9-19-37-30)32(33(34)35)41-31-15-7-10-20-38-31/h2-4,12-13,24,26-28,30-31H,1,5-11,14-22H2,(H,34,35)/t24-,26-,27+,28?,30?,31?/m0/s1 |
| InChIKey | YXCPSOQMCBPIKZ-HWMJEKDWSA-N |
| XLogP | 6.75 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|