C11H23NO3 — CID 54532018
[(2R)-1-hydroxy-4-methylpentan-2-yl] N-tert-butylcarbamate (PubChem CID 54532018) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is [(2R)-1-hydroxy-4-methylpentan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2R)-1-hydroxy-4-methylpentan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 54532018 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | [(2R)-1-hydroxy-4-methylpentan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)C[C@H](CO)OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-8(2)6-9(7-13)15-10(14)12-11(3,4)5/h8-9,13H,6-7H2,1-5H3,(H,12,14)/t9-/m1/s1 |
| InChIKey | YXEZDQYEDLCQGY-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |