C14H8BrF4N3O3 — CID 54532060
8-(4-bromo-2-fluoro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidine-2,3,7-trione;difluoromethane (PubChem CID 54532060) has the molecular formula C14H8BrF4N3O3 and a molecular weight of 422.13 g/mol. Its IUPAC name is 8-(4-bromo-2-fluoro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidine-2,3,7-trione;difluoromethane.
| Compound Name | 8-(4-bromo-2-fluoro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidine-2,3,7-trione;difluoromethane |
|---|---|
| PubChem CID | 54532060 |
| Molecular Formula | C14H8BrF4N3O3 |
| Molecular Weight | 422.13 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 8-(4-bromo-2-fluoro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidine-2,3,7-trione;difluoromethane |
| SMILES | Cc1cc(N2C(=O)C=C(F)N3C(=O)C(=O)N=C32)c(F)cc1Br.FCF |
| InChI | InChI=1S/C13H6BrF2N3O3.CH2F2/c1-5-2-8(7(15)3-6(5)14)18-10(20)4-9(16)19-12(22)11(21)17-13(18)19;2-1-3/h2-4H,1H3;1H2 |
| InChIKey | YXFSNZBFSPMKCW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|