C31H39F3N4O2 — CID 54532459
(2S)-1-methyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 54532459) has the molecular formula C31H39F3N4O2 and a molecular weight of 556.67 g/mol. Its IUPAC name is (2S)-1-methyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-methyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54532459 |
| Molecular Formula | C31H39F3N4O2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (2S)-1-methyl-N-[1-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | CN1CCC[C@H]1C(=O)NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C31H39F3N4O2/c1-37-17-8-13-27(37)28(39)36-22-14-19-38(20-15-22)18-7-6-16-30(29(40)35-21-31(32,33)34)25-11-4-2-9-23(25)24-10-3-5-12-26(24)30/h2-5,9-12,22,27H,6-8,13-21H2,1H3,(H,35,40)(H,36,39)/t27-/m0/s1 |
| InChIKey | YXLZYVQMNWDBAC-MHZLTWQESA-N |
| XLogP | 4.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|