C9H17N3 — CID 54532530
1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-imine (PubChem CID 54532530) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-imine.
| Compound Name | 1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-imine |
|---|---|
| PubChem CID | 54532530 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1,3-dimethyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-imine |
| SMILES | [H]N=C1N(C)C2CCCCC2N1C |
| InChI | InChI=1S/C9H17N3/c1-11-7-5-3-4-6-8(7)12(2)9(11)10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | OWJBBHDEWLIJJV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|