C37H48N2O5 — CID 54534195
2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid (PubChem CID 54534195) has the molecular formula C37H48N2O5 and a molecular weight of 600.80 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54534195 |
| Molecular Formula | C37H48N2O5 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[4-[4-(3-methylbutoxy)phenyl]butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(C=Cc2cccc(COCCCCc3ccc(OCCC(C)C)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C37H48N2O5/c1-5-37(6-2,36(41)42)26-35(40)39-32-14-9-12-30(25-32)16-19-31-13-10-15-33(38-31)27-43-23-8-7-11-29-17-20-34(21-18-29)44-24-22-28(3)4/h9-10,12-21,25,28H,5-8,11,22-24,26-27H2,1-4H3,(H,39,40)(H,41,42) |
| InChIKey | YYQGBRZBAIYWGB-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|