C18H21N3O2 — CID 54534525
N,N-dimethyl-3-(9-nitro-5,6-dihydropyrrolo[1,2-c][3]benzazepin-11-ylidene)propan-1-amine (PubChem CID 54534525) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N,N-dimethyl-3-(9-nitro-5,6-dihydropyrrolo[1,2-c][3]benzazepin-11-ylidene)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(9-nitro-5,6-dihydropyrrolo[1,2-c][3]benzazepin-11-ylidene)propan-1-amine |
|---|---|
| PubChem CID | 54534525 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N,N-dimethyl-3-(9-nitro-5,6-dihydropyrrolo[1,2-c][3]benzazepin-11-ylidene)propan-1-amine |
| SMILES | CN(C)CCC=C1c2cc([N+](=O)[O-])ccc2CCn2cccc21 |
| InChI | InChI=1S/C18H21N3O2/c1-19(2)10-3-5-16-17-13-15(21(22)23)8-7-14(17)9-12-20-11-4-6-18(16)20/h4-8,11,13H,3,9-10,12H2,1-2H3 |
| InChIKey | YYVOAPNNYJCYKQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|