About bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite
bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite (PubChem CID 54534600) has the molecular formula C31H49O3P
and a molecular weight of 500.70 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite.
Molecular Properties
| Compound Name | bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite |
| PubChem CID | 54534600 |
| Molecular Formula | C31H49O3P |
| Molecular Weight | 500.70 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite |
| SMILES | COP(Oc1ccc(C(C)(C)C)c(C)c1C(C)(C)C)Oc1ccc(C(C)(C)C)c(C)c1C(C)(C)C |
| InChI | InChI=1S/C31H49O3P/c1-20-22(28(3,4)5)16-18-24(26(20)30(9,10)11)33-35(32-15)34-25-19-17-23(29(6,7)8)21(2)27(25)31(12,13)14/h16-19H,1-15H3 |
| InChIKey | YYXCONLFXBTMTA-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.70 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite?
The IUPAC name of bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite (CID 54534600) is bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite.
What is the SMILES notation for bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite?
The canonical SMILES for bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite is COP(Oc1ccc(C(C)(C)C)c(C)c1C(C)(C)C)Oc1ccc(C(C)(C)C)c(C)c1C(C)(C)C.
What is the InChIKey of bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite?
The InChIKey is YYXCONLFXBTMTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H49O3P/c1-20-22(28(3,4)5)16-18-24(26(20)30(9,10)11)33-35(32-15)34-25-19-17-23(29(6,7)8)21(2)27(25)31(12,13)14/h16-19H,1-15H3.
What are the key properties of bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite?
bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite has a molecular weight of 500.70 g/mol, XLogP of 9.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4-ditert-butyl-3-methylphenyl) methyl phosphite is sourced from PubChem (CID 54534600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).