C11H19N5O3 — CID 54534613
2-(diethylamino)-N-[2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethyl]acetamide (PubChem CID 54534613) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(diethylamino)-N-[2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 54534613 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-(diethylamino)-N-[2-(5,6-dioxo-1H-1,2,4-triazin-4-yl)ethyl]acetamide |
| SMILES | CCN(CC)CC(=O)NCCn1cn[nH]c(=O)c1=O |
| InChI | InChI=1S/C11H19N5O3/c1-3-15(4-2)7-9(17)12-5-6-16-8-13-14-10(18)11(16)19/h8H,3-7H2,1-2H3,(H,12,17)(H,14,18) |
| InChIKey | DBJHACYNLQETNU-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|