About 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione
7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione (PubChem CID 54534836) has the molecular formula C13H22N5O2+
and a molecular weight of 280.35 g/mol. Its IUPAC name is 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione.
Molecular Properties
| Compound Name | 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione |
| PubChem CID | 54534836 |
| Molecular Formula | C13H22N5O2+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione |
| SMILES | CC(N)CCCC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H21N5O2/c1-9(14)6-4-5-7-18(3)8-15-11-10(18)12(19)16-13(20)17(11)2/h8-9H,4-7,14H2,1-3H3/p+1 |
| InChIKey | PJZDAKSJQJLGFE-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione?
The IUPAC name of 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione (CID 54534836) is 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione.
What is the SMILES notation for 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione?
The canonical SMILES for 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione is CC(N)CCCC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C.
What is the InChIKey of 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione?
The InChIKey is PJZDAKSJQJLGFE-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H21N5O2/c1-9(14)6-4-5-7-18(3)8-15-11-10(18)12(19)16-13(20)17(11)2/h8-9H,4-7,14H2,1-3H3/p+1.
What are the key properties of 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione?
7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione has a molecular weight of 280.35 g/mol, XLogP of 0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-aminohexyl)-3,7-dimethylpurin-7-ium-2,6-dione is sourced from PubChem (CID 54534836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).