About 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole
5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole (PubChem CID 54534912) has the molecular formula C6H7F2NS
and a molecular weight of 163.19 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole |
| PubChem CID | 54534912 |
| Molecular Formula | C6H7F2NS |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole |
| SMILES | Cc1cc(CC(F)F)sn1 |
| InChI | InChI=1S/C6H7F2NS/c1-4-2-5(10-9-4)3-6(7)8/h2,6H,3H2,1H3 |
| InChIKey | CFYPAZBVUCAWPL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole?
The IUPAC name of 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole (CID 54534912) is 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole.
What is the SMILES notation for 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole?
The canonical SMILES for 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole is Cc1cc(CC(F)F)sn1.
What is the InChIKey of 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole?
The InChIKey is CFYPAZBVUCAWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2NS/c1-4-2-5(10-9-4)3-6(7)8/h2,6H,3H2,1H3.
What are the key properties of 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole?
5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole has a molecular weight of 163.19 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethyl)-3-methyl-1,2-thiazole is sourced from PubChem (CID 54534912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).