About 3-dodecylsulfanylpropyl 3-oxobutanoate
3-dodecylsulfanylpropyl 3-oxobutanoate (PubChem CID 54535816) has the molecular formula C19H36O3S
and a molecular weight of 344.56 g/mol. Its IUPAC name is 3-dodecylsulfanylpropyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 3-dodecylsulfanylpropyl 3-oxobutanoate |
| PubChem CID | 54535816 |
| Molecular Formula | C19H36O3S |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 3-dodecylsulfanylpropyl 3-oxobutanoate |
| SMILES | CCCCCCCCCCCCSCCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C19H36O3S/c1-3-4-5-6-7-8-9-10-11-12-15-23-16-13-14-22-19(21)17-18(2)20/h3-17H2,1-2H3 |
| InChIKey | YZRWTVCLSQSOAH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecylsulfanylpropyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecylsulfanylpropyl 3-oxobutanoate?
The IUPAC name of 3-dodecylsulfanylpropyl 3-oxobutanoate (CID 54535816) is 3-dodecylsulfanylpropyl 3-oxobutanoate.
What is the SMILES notation for 3-dodecylsulfanylpropyl 3-oxobutanoate?
The canonical SMILES for 3-dodecylsulfanylpropyl 3-oxobutanoate is CCCCCCCCCCCCSCCCOC(=O)CC(C)=O.
What is the InChIKey of 3-dodecylsulfanylpropyl 3-oxobutanoate?
The InChIKey is YZRWTVCLSQSOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O3S/c1-3-4-5-6-7-8-9-10-11-12-15-23-16-13-14-22-19(21)17-18(2)20/h3-17H2,1-2H3.
What are the key properties of 3-dodecylsulfanylpropyl 3-oxobutanoate?
3-dodecylsulfanylpropyl 3-oxobutanoate has a molecular weight of 344.56 g/mol, XLogP of 5.55, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecylsulfanylpropyl 3-oxobutanoate is sourced from PubChem (CID 54535816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).