C26H8F18O2 — CID 54536117
1,2-bis(2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4-trifluorophenyl)ethane-1,2-diol (PubChem CID 54536117) has the molecular formula C26H8F18O2 and a molecular weight of 694.31 g/mol. Its IUPAC name is 1,2-bis(2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4-trifluorophenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4-trifluorophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 54536117 |
| Molecular Formula | C26H8F18O2 |
| Molecular Weight | 694.31 g/mol |
| Exact Mass | 694.02 |
| IUPAC Name | 1,2-bis(2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl)-1-(2,3,4,5,6-pentafluorophenyl)-2-(2,3,4-trifluorophenyl)ethane-1,2-diol |
| SMILES | OC(C1=C(F)C(F)C(F)C(F)=C1F)(c1ccc(F)c(F)c1F)C(O)(C1=C(F)C(F)C(F)C(F)=C1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H8F18O2/c27-4-2-1-3(8(28)9(4)29)25(45,5-10(30)16(36)22(42)17(37)11(5)31)26(46,6-12(32)18(38)23(43)19(39)13(6)33)7-14(34)20(40)24(44)21(41)15(7)35/h1-2,16,18,22-23,45-46H |
| InChIKey | YZWXCTOKYYUHGW-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.31 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|