C25H46O7 — CID 54536856
[(3R,4S,5R,6R)-4,5,6,7-tetrahydroxy-2-oxoheptan-3-yl] octadec-9-enoate (PubChem CID 54536856) has the molecular formula C25H46O7 and a molecular weight of 458.64 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5,6,7-tetrahydroxy-2-oxoheptan-3-yl] octadec-9-enoate.
| Compound Name | [(3R,4S,5R,6R)-4,5,6,7-tetrahydroxy-2-oxoheptan-3-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 54536856 |
| Molecular Formula | C25H46O7 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5,6,7-tetrahydroxy-2-oxoheptan-3-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O[C@@H](C(C)=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C25H46O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(29)32-25(20(2)27)24(31)23(30)21(28)19-26/h10-11,21,23-26,28,30-31H,3-9,12-19H2,1-2H3/t21-,23-,24+,25+/m1/s1 |
| InChIKey | ZAJSRFBXWWERJU-VGCGRUFVSA-N |
| XLogP | 3.60 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|