C12H11NO4 — CID 54537503
5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 54537503) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 54537503 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | Cc1cc(C=C2OC(=O)NC2=O)cc(C)c1O |
| InChI | InChI=1S/C12H11NO4/c1-6-3-8(4-7(2)10(6)14)5-9-11(15)13-12(16)17-9/h3-5,14H,1-2H3,(H,13,15,16) |
| InChIKey | ZAVFXUIHTLBPDU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|