About 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide
2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide (PubChem CID 54538349) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide.
Molecular Properties
| Compound Name | 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide |
| PubChem CID | 54538349 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1c(C)cc(C)n(C)c1=O |
| InChI | InChI=1S/C12H16N2O2/c1-7(2)11(15)13-10-8(3)6-9(4)14(5)12(10)16/h6H,1H2,2-5H3,(H,13,15) |
| InChIKey | ZBJGVDUERIOCPM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
The IUPAC name of 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide (CID 54538349) is 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide.
What is the SMILES notation for 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
The canonical SMILES for 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide is C=C(C)C(=O)Nc1c(C)cc(C)n(C)c1=O.
What is the InChIKey of 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
The InChIKey is ZBJGVDUERIOCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-7(2)11(15)13-10-8(3)6-9(4)14(5)12(10)16/h6H,1H2,2-5H3,(H,13,15).
What are the key properties of 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide?
2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide has a molecular weight of 220.27 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(1,4,6-trimethyl-2-oxo-3-pyridinyl)prop-2-enamide is sourced from PubChem (CID 54538349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).