About undeca-1,10-dien-3-ylcyclohexane
undeca-1,10-dien-3-ylcyclohexane (PubChem CID 54538592) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is undeca-1,10-dien-3-ylcyclohexane.
Molecular Properties
| Compound Name | undeca-1,10-dien-3-ylcyclohexane |
| PubChem CID | 54538592 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | undeca-1,10-dien-3-ylcyclohexane |
| SMILES | C=CCCCCCCC(C=C)C1CCCCC1 |
| InChI | InChI=1S/C17H30/c1-3-5-6-7-8-10-13-16(4-2)17-14-11-9-12-15-17/h3-4,16-17H,1-2,5-15H2 |
| InChIKey | ZBNCMFHFLGISCE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undeca-1,10-dien-3-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undeca-1,10-dien-3-ylcyclohexane?
The IUPAC name of undeca-1,10-dien-3-ylcyclohexane (CID 54538592) is undeca-1,10-dien-3-ylcyclohexane.
What is the SMILES notation for undeca-1,10-dien-3-ylcyclohexane?
The canonical SMILES for undeca-1,10-dien-3-ylcyclohexane is C=CCCCCCCC(C=C)C1CCCCC1.
What is the InChIKey of undeca-1,10-dien-3-ylcyclohexane?
The InChIKey is ZBNCMFHFLGISCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30/c1-3-5-6-7-8-10-13-16(4-2)17-14-11-9-12-15-17/h3-4,16-17H,1-2,5-15H2.
What are the key properties of undeca-1,10-dien-3-ylcyclohexane?
undeca-1,10-dien-3-ylcyclohexane has a molecular weight of 234.43 g/mol, XLogP of 5.90, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for undeca-1,10-dien-3-ylcyclohexane is sourced from PubChem (CID 54538592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).