About [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate
[4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate (PubChem CID 54539154) has the molecular formula C22H35NO2S
and a molecular weight of 377.59 g/mol. Its IUPAC name is [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate.
Molecular Properties
| Compound Name | [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate |
| PubChem CID | 54539154 |
| Molecular Formula | C22H35NO2S |
| Molecular Weight | 377.59 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc2c(c1C(C)(C)C)CC(C)(CN(C)C)S2 |
| InChI | InChI=1S/C22H35NO2S/c1-14(24)25-19-16(20(2,3)4)11-17-15(18(19)21(5,6)7)12-22(8,26-17)13-23(9)10/h11H,12-13H2,1-10H3 |
| InChIKey | ZBXAYTAALIHCDH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate?
The IUPAC name of [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate (CID 54539154) is [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate.
What is the SMILES notation for [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate?
The canonical SMILES for [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate is CC(=O)Oc1c(C(C)(C)C)cc2c(c1C(C)(C)C)CC(C)(CN(C)C)S2.
What is the InChIKey of [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate?
The InChIKey is ZBXAYTAALIHCDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO2S/c1-14(24)25-19-16(20(2,3)4)11-17-15(18(19)21(5,6)7)12-22(8,26-17)13-23(9)10/h11H,12-13H2,1-10H3.
What are the key properties of [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate?
[4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate has a molecular weight of 377.59 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,6-ditert-butyl-2-[(dimethylamino)methyl]-2-methyl-3H-1-benzothiophen-5-yl] acetate is sourced from PubChem (CID 54539154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).