About [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate (PubChem CID 54539156) has the molecular formula C17H16F6O2S
and a molecular weight of 398.37 g/mol. Its IUPAC name is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate |
| PubChem CID | 54539156 |
| Molecular Formula | C17H16F6O2S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H16F6O2S/c1-2-3-4-12-5-7-13(8-6-12)17(24)25-14-9-10-16(15(18)11-14)26(19,20,21,22)23/h5-11H,2-4H2,1H3 |
| InChIKey | ZBXBSRUIPFDXNV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate?
The IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate (CID 54539156) is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate.
What is the SMILES notation for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate?
The canonical SMILES for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate is CCCCc1ccc(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)cc1.
What is the InChIKey of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate?
The InChIKey is ZBXBSRUIPFDXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F6O2S/c1-2-3-4-12-5-7-13(8-6-12)17(24)25-14-9-10-16(15(18)11-14)26(19,20,21,22)23/h5-11H,2-4H2,1H3.
What are the key properties of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate?
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate has a molecular weight of 398.37 g/mol, XLogP of 7.04, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-butylbenzoate is sourced from PubChem (CID 54539156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).