C26H38O6 — CID 54539387
ditert-butyl 1-cycloocta-3,5-dien-1-yl-6,7-dioxocyclooctane-1,2-dicarboxylate (PubChem CID 54539387) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is ditert-butyl 1-cycloocta-3,5-dien-1-yl-6,7-dioxocyclooctane-1,2-dicarboxylate.
| Compound Name | ditert-butyl 1-cycloocta-3,5-dien-1-yl-6,7-dioxocyclooctane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54539387 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | ditert-butyl 1-cycloocta-3,5-dien-1-yl-6,7-dioxocyclooctane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCC(=O)C(=O)CC1(C(=O)OC(C)(C)C)C1CC=CC=CCC1 |
| InChI | InChI=1S/C26H38O6/c1-24(2,3)31-22(29)19-15-12-16-20(27)21(28)17-26(19,23(30)32-25(4,5)6)18-13-10-8-7-9-11-14-18/h7-10,18-19H,11-17H2,1-6H3 |
| InChIKey | ZCAZCVKGYMPMGB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|