C17H22N4O2 — CID 54539716
8-[1,3-bis(prop-2-enyl)cyclohexyl]-3,7-dihydropurine-2,6-dione (PubChem CID 54539716) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 8-[1,3-bis(prop-2-enyl)cyclohexyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[1,3-bis(prop-2-enyl)cyclohexyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 54539716 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 8-[1,3-bis(prop-2-enyl)cyclohexyl]-3,7-dihydropurine-2,6-dione |
| SMILES | C=CCC1CCCC(CC=C)(c2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)C1 |
| InChI | InChI=1S/C17H22N4O2/c1-3-6-11-7-5-9-17(10-11,8-4-2)15-18-12-13(19-15)20-16(23)21-14(12)22/h3-4,11H,1-2,5-10H2,(H3,18,19,20,21,22,23) |
| InChIKey | ZCHDJYZNBGXOLA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|