About [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate
[3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate (PubChem CID 54540252) has the molecular formula C21H28O8
and a molecular weight of 408.45 g/mol. Its IUPAC name is [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate.
Molecular Properties
| Compound Name | [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate |
| PubChem CID | 54540252 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(COC(=O)C=CC)(COC(=O)C=CC)COC(=O)C=CC |
| InChI | InChI=1S/C21H28O8/c1-5-9-17(22)26-13-21(14-27-18(23)10-6-2,15-28-19(24)11-7-3)16-29-20(25)12-8-4/h5-12H,13-16H2,1-4H3 |
| InChIKey | ZCQYHKYUSARBOB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate?
The IUPAC name of [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate (CID 54540252) is [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate.
What is the SMILES notation for [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate?
The canonical SMILES for [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate is CC=CC(=O)OCC(COC(=O)C=CC)(COC(=O)C=CC)COC(=O)C=CC.
What is the InChIKey of [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate?
The InChIKey is ZCQYHKYUSARBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O8/c1-5-9-17(22)26-13-21(14-27-18(23)10-6-2,15-28-19(24)11-7-3)16-29-20(25)12-8-4/h5-12H,13-16H2,1-4H3.
What are the key properties of [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate?
[3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate has a molecular weight of 408.45 g/mol, XLogP of 2.45, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-but-2-enoyloxy-2,2-bis(but-2-enoyloxymethyl)propyl] but-2-enoate is sourced from PubChem (CID 54540252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).